C15H19N5O4 — CID 133463472
4-[methyl-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]amino]-3-nitro-N-propan-2-ylbenzamide (PubChem CID 133463472) has the molecular formula C15H19N5O4 and a molecular weight of 333.35 g/mol. Its IUPAC name is 4-[methyl-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]amino]-3-nitro-N-propan-2-ylbenzamide.
| Compound Name | 4-[methyl-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]amino]-3-nitro-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 133463472 |
| Molecular Formula | C15H19N5O4 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 4-[methyl-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]amino]-3-nitro-N-propan-2-ylbenzamide |
| SMILES | Cc1nc(CN(C)c2ccc(C(=O)NC(C)C)cc2[N+](=O)[O-])no1 |
| InChI | InChI=1S/C15H19N5O4/c1-9(2)16-15(21)11-5-6-12(13(7-11)20(22)23)19(4)8-14-17-10(3)24-18-14/h5-7,9H,8H2,1-4H3,(H,16,21) |
| InChIKey | GDXIDQYTZKAXDS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|