C16H25N3 — CID 133463983
3-methyl-1-(2-propan-2-ylpyrimidin-4-yl)-2,3,3a,4,5,6,7,7a-octahydroindole (PubChem CID 133463983) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is 3-methyl-1-(2-propan-2-ylpyrimidin-4-yl)-2,3,3a,4,5,6,7,7a-octahydroindole.
| Compound Name | 3-methyl-1-(2-propan-2-ylpyrimidin-4-yl)-2,3,3a,4,5,6,7,7a-octahydroindole |
|---|---|
| PubChem CID | 133463983 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 3-methyl-1-(2-propan-2-ylpyrimidin-4-yl)-2,3,3a,4,5,6,7,7a-octahydroindole |
| SMILES | CC(C)c1nccc(N2CC(C)C3CCCCC32)n1 |
| InChI | InChI=1S/C16H25N3/c1-11(2)16-17-9-8-15(18-16)19-10-12(3)13-6-4-5-7-14(13)19/h8-9,11-14H,4-7,10H2,1-3H3 |
| InChIKey | GIBXWWRUXRVFLS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |