C19H25N3 — CID 166382778
4-[2-methyl-4-(4-methylphenyl)pyrrolidin-1-yl]-2-propan-2-ylpyrimidine (PubChem CID 166382778) has the molecular formula C19H25N3 and a molecular weight of 295.43 g/mol. Its IUPAC name is 4-[2-methyl-4-(4-methylphenyl)pyrrolidin-1-yl]-2-propan-2-ylpyrimidine.
| Compound Name | 4-[2-methyl-4-(4-methylphenyl)pyrrolidin-1-yl]-2-propan-2-ylpyrimidine |
|---|---|
| PubChem CID | 166382778 |
| Molecular Formula | C19H25N3 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | 4-[2-methyl-4-(4-methylphenyl)pyrrolidin-1-yl]-2-propan-2-ylpyrimidine |
| SMILES | Cc1ccc(C2CC(C)N(c3ccnc(C(C)C)n3)C2)cc1 |
| InChI | InChI=1S/C19H25N3/c1-13(2)19-20-10-9-18(21-19)22-12-17(11-15(22)4)16-7-5-14(3)6-8-16/h5-10,13,15,17H,11-12H2,1-4H3 |
| InChIKey | VIBWJBYLWYJYKI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |