C22H30N4 — CID 166382768
N-cyclohexyl-N-methyl-4-(2-methyl-4-phenylpyrrolidin-1-yl)pyrimidin-2-amine (PubChem CID 166382768) has the molecular formula C22H30N4 and a molecular weight of 350.51 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-4-(2-methyl-4-phenylpyrrolidin-1-yl)pyrimidin-2-amine.
| Compound Name | N-cyclohexyl-N-methyl-4-(2-methyl-4-phenylpyrrolidin-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 166382768 |
| Molecular Formula | C22H30N4 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | N-cyclohexyl-N-methyl-4-(2-methyl-4-phenylpyrrolidin-1-yl)pyrimidin-2-amine |
| SMILES | CC1CC(c2ccccc2)CN1c1ccnc(N(C)C2CCCCC2)n1 |
| InChI | InChI=1S/C22H30N4/c1-17-15-19(18-9-5-3-6-10-18)16-26(17)21-13-14-23-22(24-21)25(2)20-11-7-4-8-12-20/h3,5-6,9-10,13-14,17,19-20H,4,7-8,11-12,15-16H2,1-2H3 |
| InChIKey | NRSJXLAJGVHHDF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |