About 6-ethoxy-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]pyrimidin-4-amine
6-ethoxy-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]pyrimidin-4-amine (PubChem CID 133464678) has the molecular formula C16H16N4O2
and a molecular weight of 296.33 g/mol. Its IUPAC name is 6-ethoxy-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-ethoxy-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]pyrimidin-4-amine |
| PubChem CID | 133464678 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 6-ethoxy-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]pyrimidin-4-amine |
| SMILES | CCOc1cc(NCc2coc(-c3ccccc3)n2)ncn1 |
| InChI | InChI=1S/C16H16N4O2/c1-2-21-15-8-14(18-11-19-15)17-9-13-10-22-16(20-13)12-6-4-3-5-7-12/h3-8,10-11H,2,9H2,1H3,(H,17,18,19) |
| InChIKey | JWWOPLKOVSOCML-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-ethoxy-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]pyrimidin-4-amine?
The IUPAC name of 6-ethoxy-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]pyrimidin-4-amine (CID 133464678) is 6-ethoxy-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]pyrimidin-4-amine.
What is the SMILES notation for 6-ethoxy-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]pyrimidin-4-amine?
The canonical SMILES for 6-ethoxy-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]pyrimidin-4-amine is CCOc1cc(NCc2coc(-c3ccccc3)n2)ncn1.
What is the InChIKey of 6-ethoxy-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]pyrimidin-4-amine?
The InChIKey is JWWOPLKOVSOCML-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4O2/c1-2-21-15-8-14(18-11-19-15)17-9-13-10-22-16(20-13)12-6-4-3-5-7-12/h3-8,10-11H,2,9H2,1H3,(H,17,18,19).
What are the key properties of 6-ethoxy-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]pyrimidin-4-amine?
6-ethoxy-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]pyrimidin-4-amine has a molecular weight of 296.33 g/mol, XLogP of 3.14, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]pyrimidin-4-amine is sourced from PubChem (CID 133464678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).