About 1-tert-butyl-4-[4-[(3-methoxyphenyl)methyl]piperidin-1-yl]pyrazolo[5,4-d]pyrimidine
1-tert-butyl-4-[4-[(3-methoxyphenyl)methyl]piperidin-1-yl]pyrazolo[5,4-d]pyrimidine (PubChem CID 133464925) has the molecular formula C22H29N5O
and a molecular weight of 379.51 g/mol. Its IUPAC name is 1-tert-butyl-4-[4-[(3-methoxyphenyl)methyl]piperidin-1-yl]pyrazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 1-tert-butyl-4-[4-[(3-methoxyphenyl)methyl]piperidin-1-yl]pyrazolo[5,4-d]pyrimidine |
| PubChem CID | 133464925 |
| Molecular Formula | C22H29N5O |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 1-tert-butyl-4-[4-[(3-methoxyphenyl)methyl]piperidin-1-yl]pyrazolo[5,4-d]pyrimidine |
| SMILES | COc1cccc(CC2CCN(c3ncnc4c3cnn4C(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C22H29N5O/c1-22(2,3)27-21-19(14-25-27)20(23-15-24-21)26-10-8-16(9-11-26)12-17-6-5-7-18(13-17)28-4/h5-7,13-16H,8-12H2,1-4H3 |
| InChIKey | XBGZWTTVVWLQMO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-tert-butyl-4-[4-[(3-methoxyphenyl)methyl]piperidin-1-yl]pyrazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-[4-[(3-methoxyphenyl)methyl]piperidin-1-yl]pyrazolo[5,4-d]pyrimidine?
The IUPAC name of 1-tert-butyl-4-[4-[(3-methoxyphenyl)methyl]piperidin-1-yl]pyrazolo[5,4-d]pyrimidine (CID 133464925) is 1-tert-butyl-4-[4-[(3-methoxyphenyl)methyl]piperidin-1-yl]pyrazolo[5,4-d]pyrimidine.
What is the SMILES notation for 1-tert-butyl-4-[4-[(3-methoxyphenyl)methyl]piperidin-1-yl]pyrazolo[5,4-d]pyrimidine?
The canonical SMILES for 1-tert-butyl-4-[4-[(3-methoxyphenyl)methyl]piperidin-1-yl]pyrazolo[5,4-d]pyrimidine is COc1cccc(CC2CCN(c3ncnc4c3cnn4C(C)(C)C)CC2)c1.
What is the InChIKey of 1-tert-butyl-4-[4-[(3-methoxyphenyl)methyl]piperidin-1-yl]pyrazolo[5,4-d]pyrimidine?
The InChIKey is XBGZWTTVVWLQMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29N5O/c1-22(2,3)27-21-19(14-25-27)20(23-15-24-21)26-10-8-16(9-11-26)12-17-6-5-7-18(13-17)28-4/h5-7,13-16H,8-12H2,1-4H3.
What are the key properties of 1-tert-butyl-4-[4-[(3-methoxyphenyl)methyl]piperidin-1-yl]pyrazolo[5,4-d]pyrimidine?
1-tert-butyl-4-[4-[(3-methoxyphenyl)methyl]piperidin-1-yl]pyrazolo[5,4-d]pyrimidine has a molecular weight of 379.51 g/mol, XLogP of 4.05, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-[4-[(3-methoxyphenyl)methyl]piperidin-1-yl]pyrazolo[5,4-d]pyrimidine is sourced from PubChem (CID 133464925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).