ethyl 3-[methyl-(8-methylquinazolin-4-yl)amino]butanoate

C16H21N3O2 — CID 133465027

IUPACethyl 3-[methyl-(8-methylquinazolin-4-yl)amino]butanoate
SMILESCCOC(=O)CC(C)N(C)c1ncnc2c(C)cccc12
InChIInChI=1S/C16H21N3O2/c1-5-21-14(20)9-12(3)19(4)16-13-8-6-7-11(2)15(13)17-10-18-16/h6-8,10,12H,5,9H2,1-4H3
InChIKeySPLBOQCRXLEBKZ-UHFFFAOYSA-N
MW287.36 g/mol
LogP2.72
Rot. Bonds5

About ethyl 3-[methyl-(8-methylquinazolin-4-yl)amino]butanoate

ethyl 3-[methyl-(8-methylquinazolin-4-yl)amino]butanoate (PubChem CID 133465027) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is ethyl 3-[methyl-(8-methylquinazolin-4-yl)amino]butanoate.

Molecular Properties

Compound Nameethyl 3-[methyl-(8-methylquinazolin-4-yl)amino]butanoate
PubChem CID133465027
Molecular FormulaC16H21N3O2
Molecular Weight287.36 g/mol
Exact Mass287.16
IUPAC Nameethyl 3-[methyl-(8-methylquinazolin-4-yl)amino]butanoate
SMILESCCOC(=O)CC(C)N(C)c1ncnc2c(C)cccc12
InChIInChI=1S/C16H21N3O2/c1-5-21-14(20)9-12(3)19(4)16-13-8-6-7-11(2)15(13)17-10-18-16/h6-8,10,12H,5,9H2,1-4H3
InChIKeySPLBOQCRXLEBKZ-UHFFFAOYSA-N
XLogP2.72
TPSA55.32 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500287.36
LogP ≤ 52.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze ethyl 3-[methyl-(8-methylquinazolin-4-yl)amino]butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 3-[methyl-(8-methylquinazolin-4-yl)amino]butanoate?
The IUPAC name of ethyl 3-[methyl-(8-methylquinazolin-4-yl)amino]butanoate (CID 133465027) is ethyl 3-[methyl-(8-methylquinazolin-4-yl)amino]butanoate.
What is the SMILES notation for ethyl 3-[methyl-(8-methylquinazolin-4-yl)amino]butanoate?
The canonical SMILES for ethyl 3-[methyl-(8-methylquinazolin-4-yl)amino]butanoate is CCOC(=O)CC(C)N(C)c1ncnc2c(C)cccc12.
What is the InChIKey of ethyl 3-[methyl-(8-methylquinazolin-4-yl)amino]butanoate?
The InChIKey is SPLBOQCRXLEBKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O2/c1-5-21-14(20)9-12(3)19(4)16-13-8-6-7-11(2)15(13)17-10-18-16/h6-8,10,12H,5,9H2,1-4H3.
What are the key properties of ethyl 3-[methyl-(8-methylquinazolin-4-yl)amino]butanoate?
ethyl 3-[methyl-(8-methylquinazolin-4-yl)amino]butanoate has a molecular weight of 287.36 g/mol, XLogP of 2.72, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[methyl-(8-methylquinazolin-4-yl)amino]butanoate is sourced from PubChem (CID 133465027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).