C13H16F2N2O2 — CID 133465210
5-(difluoromethoxy)-2-(3-prop-2-enoxypyrrolidin-1-yl)pyridine (PubChem CID 133465210) has the molecular formula C13H16F2N2O2 and a molecular weight of 270.28 g/mol. Its IUPAC name is 5-(difluoromethoxy)-2-(3-prop-2-enoxypyrrolidin-1-yl)pyridine.
| Compound Name | 5-(difluoromethoxy)-2-(3-prop-2-enoxypyrrolidin-1-yl)pyridine |
|---|---|
| PubChem CID | 133465210 |
| Molecular Formula | C13H16F2N2O2 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 5-(difluoromethoxy)-2-(3-prop-2-enoxypyrrolidin-1-yl)pyridine |
| SMILES | C=CCOC1CCN(c2ccc(OC(F)F)cn2)C1 |
| InChI | InChI=1S/C13H16F2N2O2/c1-2-7-18-11-5-6-17(9-11)12-4-3-10(8-16-12)19-13(14)15/h2-4,8,11,13H,1,5-7,9H2 |
| InChIKey | IUKOXHYXXJRQGN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|