C17H14ClN5 — CID 133466787
5-chloro-6-[(1-cyclopropylbenzimidazol-2-yl)methylamino]pyridine-3-carbonitrile (PubChem CID 133466787) has the molecular formula C17H14ClN5 and a molecular weight of 323.79 g/mol. Its IUPAC name is 5-chloro-6-[(1-cyclopropylbenzimidazol-2-yl)methylamino]pyridine-3-carbonitrile.
| Compound Name | 5-chloro-6-[(1-cyclopropylbenzimidazol-2-yl)methylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 133466787 |
| Molecular Formula | C17H14ClN5 |
| Molecular Weight | 323.79 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 5-chloro-6-[(1-cyclopropylbenzimidazol-2-yl)methylamino]pyridine-3-carbonitrile |
| SMILES | N#Cc1cnc(NCc2nc3ccccc3n2C2CC2)c(Cl)c1 |
| InChI | InChI=1S/C17H14ClN5/c18-13-7-11(8-19)9-20-17(13)21-10-16-22-14-3-1-2-4-15(14)23(16)12-5-6-12/h1-4,7,9,12H,5-6,10H2,(H,20,21) |
| InChIKey | KAUJGZFTDHCABC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.79 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |