C13H12BrN5O3 — CID 133467146
N-(2-bromophenyl)-2-[methyl-(5-nitropyrimidin-2-yl)amino]acetamide (PubChem CID 133467146) has the molecular formula C13H12BrN5O3 and a molecular weight of 366.18 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-[methyl-(5-nitropyrimidin-2-yl)amino]acetamide.
| Compound Name | N-(2-bromophenyl)-2-[methyl-(5-nitropyrimidin-2-yl)amino]acetamide |
|---|---|
| PubChem CID | 133467146 |
| Molecular Formula | C13H12BrN5O3 |
| Molecular Weight | 366.18 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | N-(2-bromophenyl)-2-[methyl-(5-nitropyrimidin-2-yl)amino]acetamide |
| SMILES | CN(CC(=O)Nc1ccccc1Br)c1ncc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C13H12BrN5O3/c1-18(13-15-6-9(7-16-13)19(21)22)8-12(20)17-11-5-3-2-4-10(11)14/h2-7H,8H2,1H3,(H,17,20) |
| InChIKey | AMXOJGJSZFHSFI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.18 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|