C19H22F2N2O2S — CID 133473353
1-benzyl-N-[4-(difluoromethylsulfonyl)phenyl]-4-methylpyrrolidin-3-amine (PubChem CID 133473353) has the molecular formula C19H22F2N2O2S and a molecular weight of 380.46 g/mol. Its IUPAC name is 1-benzyl-N-[4-(difluoromethylsulfonyl)phenyl]-4-methylpyrrolidin-3-amine.
| Compound Name | 1-benzyl-N-[4-(difluoromethylsulfonyl)phenyl]-4-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 133473353 |
| Molecular Formula | C19H22F2N2O2S |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 1-benzyl-N-[4-(difluoromethylsulfonyl)phenyl]-4-methylpyrrolidin-3-amine |
| SMILES | CC1CN(Cc2ccccc2)CC1Nc1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C19H22F2N2O2S/c1-14-11-23(12-15-5-3-2-4-6-15)13-18(14)22-16-7-9-17(10-8-16)26(24,25)19(20)21/h2-10,14,18-19,22H,11-13H2,1H3 |
| InChIKey | UIUDWMDOQFADCG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |