C18H20N2O4 — CID 133474059
N-(3-methoxy-4-nitrophenyl)-2-phenyloxan-4-amine (PubChem CID 133474059) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is N-(3-methoxy-4-nitrophenyl)-2-phenyloxan-4-amine.
| Compound Name | N-(3-methoxy-4-nitrophenyl)-2-phenyloxan-4-amine |
|---|---|
| PubChem CID | 133474059 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | N-(3-methoxy-4-nitrophenyl)-2-phenyloxan-4-amine |
| SMILES | COc1cc(NC2CCOC(c3ccccc3)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H20N2O4/c1-23-18-12-14(7-8-16(18)20(21)22)19-15-9-10-24-17(11-15)13-5-3-2-4-6-13/h2-8,12,15,17,19H,9-11H2,1H3 |
| InChIKey | JREQQTWEGGMHKX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|