C20H20N2OS — CID 133474166
4-phenyl-N-(2-phenyloxan-4-yl)-1,3-thiazol-2-amine (PubChem CID 133474166) has the molecular formula C20H20N2OS and a molecular weight of 336.46 g/mol. Its IUPAC name is 4-phenyl-N-(2-phenyloxan-4-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-phenyl-N-(2-phenyloxan-4-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 133474166 |
| Molecular Formula | C20H20N2OS |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 4-phenyl-N-(2-phenyloxan-4-yl)-1,3-thiazol-2-amine |
| SMILES | c1ccc(-c2csc(NC3CCOC(c4ccccc4)C3)n2)cc1 |
| InChI | InChI=1S/C20H20N2OS/c1-3-7-15(8-4-1)18-14-24-20(22-18)21-17-11-12-23-19(13-17)16-9-5-2-6-10-16/h1-10,14,17,19H,11-13H2,(H,21,22) |
| InChIKey | SPSBREMNDBLWCT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |