C14H15N3OS — CID 71921220
1-methyl-3-[(4-phenyl-1,3-thiazol-2-yl)amino]pyrrolidin-2-one (PubChem CID 71921220) has the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. Its IUPAC name is 1-methyl-3-[(4-phenyl-1,3-thiazol-2-yl)amino]pyrrolidin-2-one.
| Compound Name | 1-methyl-3-[(4-phenyl-1,3-thiazol-2-yl)amino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 71921220 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 1-methyl-3-[(4-phenyl-1,3-thiazol-2-yl)amino]pyrrolidin-2-one |
| SMILES | CN1CCC(Nc2nc(-c3ccccc3)cs2)C1=O |
| InChI | InChI=1S/C14H15N3OS/c1-17-8-7-11(13(17)18)15-14-16-12(9-19-14)10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3,(H,15,16) |
| InChIKey | CGEDREDPEHIKRS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |