C16H17FN4O3 — CID 133475093
5-cyclopropyl-3-[1-(2-fluoro-4-nitrophenyl)piperidin-4-yl]-1,2,4-oxadiazole (PubChem CID 133475093) has the molecular formula C16H17FN4O3 and a molecular weight of 332.34 g/mol. Its IUPAC name is 5-cyclopropyl-3-[1-(2-fluoro-4-nitrophenyl)piperidin-4-yl]-1,2,4-oxadiazole.
| Compound Name | 5-cyclopropyl-3-[1-(2-fluoro-4-nitrophenyl)piperidin-4-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 133475093 |
| Molecular Formula | C16H17FN4O3 |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 5-cyclopropyl-3-[1-(2-fluoro-4-nitrophenyl)piperidin-4-yl]-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1ccc(N2CCC(c3noc(C4CC4)n3)CC2)c(F)c1 |
| InChI | InChI=1S/C16H17FN4O3/c17-13-9-12(21(22)23)3-4-14(13)20-7-5-10(6-8-20)15-18-16(24-19-15)11-1-2-11/h3-4,9-11H,1-2,5-8H2 |
| InChIKey | ZBVIPVZUWBADRA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 85.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|