About [2-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]quinolin-3-yl]methanol
[2-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]quinolin-3-yl]methanol (PubChem CID 133475185) has the molecular formula C20H22N4O2
and a molecular weight of 350.42 g/mol. Its IUPAC name is [2-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]quinolin-3-yl]methanol.
Molecular Properties
| Compound Name | [2-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]quinolin-3-yl]methanol |
| PubChem CID | 133475185 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | [2-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]quinolin-3-yl]methanol |
| SMILES | OCc1cc2ccccc2nc1N1CCC(c2noc(C3CC3)n2)CC1 |
| InChI | InChI=1S/C20H22N4O2/c25-12-16-11-15-3-1-2-4-17(15)21-19(16)24-9-7-13(8-10-24)18-22-20(26-23-18)14-5-6-14/h1-4,11,13-14,25H,5-10,12H2 |
| InChIKey | JIVORNFBKHSZCQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]quinolin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]quinolin-3-yl]methanol?
The IUPAC name of [2-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]quinolin-3-yl]methanol (CID 133475185) is [2-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]quinolin-3-yl]methanol.
What is the SMILES notation for [2-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]quinolin-3-yl]methanol?
The canonical SMILES for [2-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]quinolin-3-yl]methanol is OCc1cc2ccccc2nc1N1CCC(c2noc(C3CC3)n2)CC1.
What is the InChIKey of [2-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]quinolin-3-yl]methanol?
The InChIKey is JIVORNFBKHSZCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4O2/c25-12-16-11-15-3-1-2-4-17(15)21-19(16)24-9-7-13(8-10-24)18-22-20(26-23-18)14-5-6-14/h1-4,11,13-14,25H,5-10,12H2.
What are the key properties of [2-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]quinolin-3-yl]methanol?
[2-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]quinolin-3-yl]methanol has a molecular weight of 350.42 g/mol, XLogP of 3.37, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]quinolin-3-yl]methanol is sourced from PubChem (CID 133475185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).