C19H19ClN4O — CID 133475197
3-[1-(1-chloroisoquinolin-3-yl)piperidin-4-yl]-5-cyclopropyl-1,2,4-oxadiazole (PubChem CID 133475197) has the molecular formula C19H19ClN4O and a molecular weight of 354.84 g/mol. Its IUPAC name is 3-[1-(1-chloroisoquinolin-3-yl)piperidin-4-yl]-5-cyclopropyl-1,2,4-oxadiazole.
| Compound Name | 3-[1-(1-chloroisoquinolin-3-yl)piperidin-4-yl]-5-cyclopropyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 133475197 |
| Molecular Formula | C19H19ClN4O |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 3-[1-(1-chloroisoquinolin-3-yl)piperidin-4-yl]-5-cyclopropyl-1,2,4-oxadiazole |
| SMILES | Clc1nc(N2CCC(c3noc(C4CC4)n3)CC2)cc2ccccc12 |
| InChI | InChI=1S/C19H19ClN4O/c20-17-15-4-2-1-3-14(15)11-16(21-17)24-9-7-12(8-10-24)18-22-19(25-23-18)13-5-6-13/h1-4,11-13H,5-10H2 |
| InChIKey | LROYAEUUIUVESR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|