C17H17ClF3N3O — CID 30869269
1-(1-chloroisoquinolin-3-yl)-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide (PubChem CID 30869269) has the molecular formula C17H17ClF3N3O and a molecular weight of 371.79 g/mol. Its IUPAC name is 1-(1-chloroisoquinolin-3-yl)-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide.
| Compound Name | 1-(1-chloroisoquinolin-3-yl)-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 30869269 |
| Molecular Formula | C17H17ClF3N3O |
| Molecular Weight | 371.79 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 1-(1-chloroisoquinolin-3-yl)-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide |
| SMILES | O=C(NCC(F)(F)F)C1CCN(c2cc3ccccc3c(Cl)n2)CC1 |
| InChI | InChI=1S/C17H17ClF3N3O/c18-15-13-4-2-1-3-12(13)9-14(23-15)24-7-5-11(6-8-24)16(25)22-10-17(19,20)21/h1-4,9,11H,5-8,10H2,(H,22,25) |
| InChIKey | HVHLDILFNGAMLH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.79 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|