About 3-N,3-N-dimethyl-2-N-(2-propan-2-yloxyethyl)pyrazine-2,3-diamine
3-N,3-N-dimethyl-2-N-(2-propan-2-yloxyethyl)pyrazine-2,3-diamine (PubChem CID 133475780) has the molecular formula C11H20N4O
and a molecular weight of 224.31 g/mol. Its IUPAC name is 3-N,3-N-dimethyl-2-N-(2-propan-2-yloxyethyl)pyrazine-2,3-diamine.
Molecular Properties
| Compound Name | 3-N,3-N-dimethyl-2-N-(2-propan-2-yloxyethyl)pyrazine-2,3-diamine |
| PubChem CID | 133475780 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 3-N,3-N-dimethyl-2-N-(2-propan-2-yloxyethyl)pyrazine-2,3-diamine |
| SMILES | CC(C)OCCNc1nccnc1N(C)C |
| InChI | InChI=1S/C11H20N4O/c1-9(2)16-8-7-13-10-11(15(3)4)14-6-5-12-10/h5-6,9H,7-8H2,1-4H3,(H,12,13) |
| InChIKey | LCCFXQGNNVRYOZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-N,3-N-dimethyl-2-N-(2-propan-2-yloxyethyl)pyrazine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N,3-N-dimethyl-2-N-(2-propan-2-yloxyethyl)pyrazine-2,3-diamine?
The IUPAC name of 3-N,3-N-dimethyl-2-N-(2-propan-2-yloxyethyl)pyrazine-2,3-diamine (CID 133475780) is 3-N,3-N-dimethyl-2-N-(2-propan-2-yloxyethyl)pyrazine-2,3-diamine.
What is the SMILES notation for 3-N,3-N-dimethyl-2-N-(2-propan-2-yloxyethyl)pyrazine-2,3-diamine?
The canonical SMILES for 3-N,3-N-dimethyl-2-N-(2-propan-2-yloxyethyl)pyrazine-2,3-diamine is CC(C)OCCNc1nccnc1N(C)C.
What is the InChIKey of 3-N,3-N-dimethyl-2-N-(2-propan-2-yloxyethyl)pyrazine-2,3-diamine?
The InChIKey is LCCFXQGNNVRYOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4O/c1-9(2)16-8-7-13-10-11(15(3)4)14-6-5-12-10/h5-6,9H,7-8H2,1-4H3,(H,12,13).
What are the key properties of 3-N,3-N-dimethyl-2-N-(2-propan-2-yloxyethyl)pyrazine-2,3-diamine?
3-N,3-N-dimethyl-2-N-(2-propan-2-yloxyethyl)pyrazine-2,3-diamine has a molecular weight of 224.31 g/mol, XLogP of 1.38, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N,3-N-dimethyl-2-N-(2-propan-2-yloxyethyl)pyrazine-2,3-diamine is sourced from PubChem (CID 133475780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).