C15H18N4O3 — CID 135118397
3-[2-[[3-(dimethylamino)pyrazin-2-yl]amino]ethoxy]benzoic acid (PubChem CID 135118397) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 3-[2-[[3-(dimethylamino)pyrazin-2-yl]amino]ethoxy]benzoic acid.
| Compound Name | 3-[2-[[3-(dimethylamino)pyrazin-2-yl]amino]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 135118397 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 3-[2-[[3-(dimethylamino)pyrazin-2-yl]amino]ethoxy]benzoic acid |
| SMILES | CN(C)c1nccnc1NCCOc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C15H18N4O3/c1-19(2)14-13(16-6-7-18-14)17-8-9-22-12-5-3-4-11(10-12)15(20)21/h3-7,10H,8-9H2,1-2H3,(H,16,17)(H,20,21) |
| InChIKey | XRRVYOSMUKXUFS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|