C20H18FN5OS2 — CID 133477332
7-ethyl-2-[[2-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]amino]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (PubChem CID 133477332) has the molecular formula C20H18FN5OS2 and a molecular weight of 427.53 g/mol. Its IUPAC name is 7-ethyl-2-[[2-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]amino]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-ethyl-2-[[2-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]amino]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 133477332 |
| Molecular Formula | C20H18FN5OS2 |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 7-ethyl-2-[[2-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]amino]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| SMILES | CCc1cc(=O)n2nc(NC3CCCc4sc(-c5ccc(F)cc5)nc43)sc2n1 |
| InChI | InChI=1S/C20H18FN5OS2/c1-2-13-10-16(27)26-20(22-13)29-19(25-26)23-14-4-3-5-15-17(14)24-18(28-15)11-6-8-12(21)9-7-11/h6-10,14H,2-5H2,1H3,(H,23,25) |
| InChIKey | OSYYNNHULKADPR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |