C18H15F2N3S — CID 133477326
2-(4-fluorophenyl)-N-(6-fluoro-2-pyridinyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine (PubChem CID 133477326) has the molecular formula C18H15F2N3S and a molecular weight of 343.40 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-(6-fluoro-2-pyridinyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine.
| Compound Name | 2-(4-fluorophenyl)-N-(6-fluoro-2-pyridinyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine |
|---|---|
| PubChem CID | 133477326 |
| Molecular Formula | C18H15F2N3S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 2-(4-fluorophenyl)-N-(6-fluoro-2-pyridinyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine |
| SMILES | Fc1ccc(-c2nc3c(s2)CCCC3Nc2cccc(F)n2)cc1 |
| InChI | InChI=1S/C18H15F2N3S/c19-12-9-7-11(8-10-12)18-23-17-13(3-1-4-14(17)24-18)21-16-6-2-5-15(20)22-16/h2,5-10,13H,1,3-4H2,(H,21,22) |
| InChIKey | FYFZILFKGPMVGT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|