About 3-bromo-4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-1-methylpyrazolo[5,4-d]pyrimidine
3-bromo-4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-1-methylpyrazolo[5,4-d]pyrimidine (PubChem CID 133480597) has the molecular formula C18H18BrF2N5
and a molecular weight of 422.28 g/mol. Its IUPAC name is 3-bromo-4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-1-methylpyrazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 3-bromo-4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-1-methylpyrazolo[5,4-d]pyrimidine |
| PubChem CID | 133480597 |
| Molecular Formula | C18H18BrF2N5 |
| Molecular Weight | 422.28 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 3-bromo-4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-1-methylpyrazolo[5,4-d]pyrimidine |
| SMILES | Cn1nc(Br)c2c(N3CCC(Cc4ccc(F)c(F)c4)CC3)ncnc21 |
| InChI | InChI=1S/C18H18BrF2N5/c1-25-17-15(16(19)24-25)18(23-10-22-17)26-6-4-11(5-7-26)8-12-2-3-13(20)14(21)9-12/h2-3,9-11H,4-8H2,1H3 |
| InChIKey | JWDXJYQUDCVPDB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-bromo-4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-1-methylpyrazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-1-methylpyrazolo[5,4-d]pyrimidine?
The IUPAC name of 3-bromo-4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-1-methylpyrazolo[5,4-d]pyrimidine (CID 133480597) is 3-bromo-4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-1-methylpyrazolo[5,4-d]pyrimidine.
What is the SMILES notation for 3-bromo-4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-1-methylpyrazolo[5,4-d]pyrimidine?
The canonical SMILES for 3-bromo-4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-1-methylpyrazolo[5,4-d]pyrimidine is Cn1nc(Br)c2c(N3CCC(Cc4ccc(F)c(F)c4)CC3)ncnc21.
What is the InChIKey of 3-bromo-4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-1-methylpyrazolo[5,4-d]pyrimidine?
The InChIKey is JWDXJYQUDCVPDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18BrF2N5/c1-25-17-15(16(19)24-25)18(23-10-22-17)26-6-4-11(5-7-26)8-12-2-3-13(20)14(21)9-12/h2-3,9-11H,4-8H2,1H3.
What are the key properties of 3-bromo-4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-1-methylpyrazolo[5,4-d]pyrimidine?
3-bromo-4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-1-methylpyrazolo[5,4-d]pyrimidine has a molecular weight of 422.28 g/mol, XLogP of 3.86, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-1-methylpyrazolo[5,4-d]pyrimidine is sourced from PubChem (CID 133480597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).