C15H12ClF2N3O2 — CID 133480647
5-chloro-2-[3-(2,6-difluorophenyl)pyrrolidin-1-yl]-3-nitropyridine (PubChem CID 133480647) has the molecular formula C15H12ClF2N3O2 and a molecular weight of 339.73 g/mol. Its IUPAC name is 5-chloro-2-[3-(2,6-difluorophenyl)pyrrolidin-1-yl]-3-nitropyridine.
| Compound Name | 5-chloro-2-[3-(2,6-difluorophenyl)pyrrolidin-1-yl]-3-nitropyridine |
|---|---|
| PubChem CID | 133480647 |
| Molecular Formula | C15H12ClF2N3O2 |
| Molecular Weight | 339.73 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 5-chloro-2-[3-(2,6-difluorophenyl)pyrrolidin-1-yl]-3-nitropyridine |
| SMILES | O=[N+]([O-])c1cc(Cl)cnc1N1CCC(c2c(F)cccc2F)C1 |
| InChI | InChI=1S/C15H12ClF2N3O2/c16-10-6-13(21(22)23)15(19-7-10)20-5-4-9(8-20)14-11(17)2-1-3-12(14)18/h1-3,6-7,9H,4-5,8H2 |
| InChIKey | RUBXCELSWDPPJP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.73 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|