C21H20Cl2N4O5 — CID 167295199
cis-(1R,2S)-2-[4-(5-chloro-3-nitro-2-pyridinyl)-3-(4-chlorophenyl)piperazine-1-carbonyl]cyclobutane-1-carboxylic acid (PubChem CID 167295199) has the molecular formula C21H20Cl2N4O5 and a molecular weight of 479.32 g/mol. Its IUPAC name is cis-(1R,2S)-2-[4-(5-chloro-3-nitro-2-pyridinyl)-3-(4-chlorophenyl)piperazine-1-carbonyl]cyclobutane-1-carboxylic acid.
| Compound Name | cis-(1R,2S)-2-[4-(5-chloro-3-nitro-2-pyridinyl)-3-(4-chlorophenyl)piperazine-1-carbonyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 167295199 |
| Molecular Formula | C21H20Cl2N4O5 |
| Molecular Weight | 479.32 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | cis-(1R,2S)-2-[4-(5-chloro-3-nitro-2-pyridinyl)-3-(4-chlorophenyl)piperazine-1-carbonyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC[C@@H]1C(=O)N1CCN(c2ncc(Cl)cc2[N+](=O)[O-])C(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C21H20Cl2N4O5/c22-13-3-1-12(2-4-13)18-11-25(20(28)15-5-6-16(15)21(29)30)7-8-26(18)19-17(27(31)32)9-14(23)10-24-19/h1-4,9-10,15-16,18H,5-8,11H2,(H,29,30)/t15-,16+,18?/m0/s1 |
| InChIKey | IPEHWMWQOLBZNB-SWQDIRLTSA-N |
| XLogP | 3.80 |
| TPSA | 116.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.32 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|