C18H21ClN2O — CID 133482369
N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-6-methylpyridin-2-amine (PubChem CID 133482369) has the molecular formula C18H21ClN2O and a molecular weight of 316.83 g/mol. Its IUPAC name is N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-6-methylpyridin-2-amine.
| Compound Name | N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-6-methylpyridin-2-amine |
|---|---|
| PubChem CID | 133482369 |
| Molecular Formula | C18H21ClN2O |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-6-methylpyridin-2-amine |
| SMILES | Cc1cccc(NCC2(c3cccc(Cl)c3)CCOCC2)n1 |
| InChI | InChI=1S/C18H21ClN2O/c1-14-4-2-7-17(21-14)20-13-18(8-10-22-11-9-18)15-5-3-6-16(19)12-15/h2-7,12H,8-11,13H2,1H3,(H,20,21) |
| InChIKey | ZYLVMNUHLAROFB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |