C18H21ClN2O2 — CID 154784297
[4-[[4-(3-chlorophenyl)oxan-4-yl]methylamino]-3-pyridinyl]methanol (PubChem CID 154784297) has the molecular formula C18H21ClN2O2 and a molecular weight of 332.83 g/mol. Its IUPAC name is [4-[[4-(3-chlorophenyl)oxan-4-yl]methylamino]-3-pyridinyl]methanol.
| Compound Name | [4-[[4-(3-chlorophenyl)oxan-4-yl]methylamino]-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 154784297 |
| Molecular Formula | C18H21ClN2O2 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | [4-[[4-(3-chlorophenyl)oxan-4-yl]methylamino]-3-pyridinyl]methanol |
| SMILES | OCc1cnccc1NCC1(c2cccc(Cl)c2)CCOCC1 |
| InChI | InChI=1S/C18H21ClN2O2/c19-16-3-1-2-15(10-16)18(5-8-23-9-6-18)13-21-17-4-7-20-11-14(17)12-22/h1-4,7,10-11,22H,5-6,8-9,12-13H2,(H,20,21) |
| InChIKey | RLHAOKIJFKPZFV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |