C18H26N4OS — CID 133484080
N-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-6-propan-2-yloxypyrazin-2-amine (PubChem CID 133484080) has the molecular formula C18H26N4OS and a molecular weight of 346.50 g/mol. Its IUPAC name is N-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-6-propan-2-yloxypyrazin-2-amine.
| Compound Name | N-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-6-propan-2-yloxypyrazin-2-amine |
|---|---|
| PubChem CID | 133484080 |
| Molecular Formula | C18H26N4OS |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | N-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-6-propan-2-yloxypyrazin-2-amine |
| SMILES | CC(C)Oc1cncc(NCC2CCCN(C)C2c2cccs2)n1 |
| InChI | InChI=1S/C18H26N4OS/c1-13(2)23-17-12-19-11-16(21-17)20-10-14-6-4-8-22(3)18(14)15-7-5-9-24-15/h5,7,9,11-14,18H,4,6,8,10H2,1-3H3,(H,20,21) |
| InChIKey | BHCWRZNWVWNFDA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |