C19H25Cl2N3S — CID 124860029
2,6-dichloro-4-[(1S)-1-[[(2R,3S)-1-methyl-2-thiophen-2-ylpiperidin-3-yl]methylamino]ethyl]aniline (PubChem CID 124860029) has the molecular formula C19H25Cl2N3S and a molecular weight of 398.40 g/mol. Its IUPAC name is 2,6-dichloro-4-[(1S)-1-[[(2R,3S)-1-methyl-2-thiophen-2-ylpiperidin-3-yl]methylamino]ethyl]aniline.
| Compound Name | 2,6-dichloro-4-[(1S)-1-[[(2R,3S)-1-methyl-2-thiophen-2-ylpiperidin-3-yl]methylamino]ethyl]aniline |
|---|---|
| PubChem CID | 124860029 |
| Molecular Formula | C19H25Cl2N3S |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 2,6-dichloro-4-[(1S)-1-[[(2R,3S)-1-methyl-2-thiophen-2-ylpiperidin-3-yl]methylamino]ethyl]aniline |
| SMILES | C[C@H](NC[C@@H]1CCCN(C)[C@H]1c1cccs1)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C19H25Cl2N3S/c1-12(14-9-15(20)18(22)16(21)10-14)23-11-13-5-3-7-24(2)19(13)17-6-4-8-25-17/h4,6,8-10,12-13,19,23H,3,5,7,11,22H2,1-2H3/t12-,13-,19+/m0/s1 |
| InChIKey | SYQUINBMOZCMBX-WTOJCKNJSA-N |
| XLogP | 5.37 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|