C18H22N2O3S — CID 124625545
2,3-dihydroxy-N-[[(2R,3S)-1-methyl-2-thiophen-2-ylpiperidin-3-yl]methyl]benzamide (PubChem CID 124625545) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is 2,3-dihydroxy-N-[[(2R,3S)-1-methyl-2-thiophen-2-ylpiperidin-3-yl]methyl]benzamide.
| Compound Name | 2,3-dihydroxy-N-[[(2R,3S)-1-methyl-2-thiophen-2-ylpiperidin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 124625545 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2,3-dihydroxy-N-[[(2R,3S)-1-methyl-2-thiophen-2-ylpiperidin-3-yl]methyl]benzamide |
| SMILES | CN1CCC[C@@H](CNC(=O)c2cccc(O)c2O)[C@@H]1c1cccs1 |
| InChI | InChI=1S/C18H22N2O3S/c1-20-9-3-5-12(16(20)15-8-4-10-24-15)11-19-18(23)13-6-2-7-14(21)17(13)22/h2,4,6-8,10,12,16,21-22H,3,5,9,11H2,1H3,(H,19,23)/t12-,16+/m0/s1 |
| InChIKey | BXLSOHHDSPUHFN-BLLLJJGKSA-N |
| XLogP | 2.97 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|