C19H26N4OS — CID 167867938
3-(3-but-3-ynyldiazirin-3-yl)-N-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]propanamide (PubChem CID 167867938) has the molecular formula C19H26N4OS and a molecular weight of 358.51 g/mol. Its IUPAC name is 3-(3-but-3-ynyldiazirin-3-yl)-N-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]propanamide.
| Compound Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]propanamide |
|---|---|
| PubChem CID | 167867938 |
| Molecular Formula | C19H26N4OS |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]propanamide |
| SMILES | C#CCCC1(CCC(=O)NCC2CCCN(C)C2c2cccs2)N=N1 |
| InChI | InChI=1S/C19H26N4OS/c1-3-4-10-19(21-22-19)11-9-17(24)20-14-15-7-5-12-23(2)18(15)16-8-6-13-25-16/h1,6,8,13,15,18H,4-5,7,9-12,14H2,2H3,(H,20,24) |
| InChIKey | BNBOAVOAGSKCDI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|