C10H10N4O3S — CID 133487746
[2-[[(3-nitro-2-pyridinyl)amino]methyl]-1,3-thiazol-4-yl]methanol (PubChem CID 133487746) has the molecular formula C10H10N4O3S and a molecular weight of 266.28 g/mol. Its IUPAC name is [2-[[(3-nitro-2-pyridinyl)amino]methyl]-1,3-thiazol-4-yl]methanol.
| Compound Name | [2-[[(3-nitro-2-pyridinyl)amino]methyl]-1,3-thiazol-4-yl]methanol |
|---|---|
| PubChem CID | 133487746 |
| Molecular Formula | C10H10N4O3S |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | [2-[[(3-nitro-2-pyridinyl)amino]methyl]-1,3-thiazol-4-yl]methanol |
| SMILES | O=[N+]([O-])c1cccnc1NCc1nc(CO)cs1 |
| InChI | InChI=1S/C10H10N4O3S/c15-5-7-6-18-9(13-7)4-12-10-8(14(16)17)2-1-3-11-10/h1-3,6,15H,4-5H2,(H,11,12) |
| InChIKey | CUDFHAMJWZJZAO-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 101.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|