About 4-(4-benzhydrylpiperazin-1-yl)-2-methylpyrazolo[1,5-a]pyrazine
4-(4-benzhydrylpiperazin-1-yl)-2-methylpyrazolo[1,5-a]pyrazine (PubChem CID 133487929) has the molecular formula C24H25N5
and a molecular weight of 383.50 g/mol. Its IUPAC name is 4-(4-benzhydrylpiperazin-1-yl)-2-methylpyrazolo[1,5-a]pyrazine.
Molecular Properties
| Compound Name | 4-(4-benzhydrylpiperazin-1-yl)-2-methylpyrazolo[1,5-a]pyrazine |
| PubChem CID | 133487929 |
| Molecular Formula | C24H25N5 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 4-(4-benzhydrylpiperazin-1-yl)-2-methylpyrazolo[1,5-a]pyrazine |
| SMILES | Cc1cc2c(N3CCN(C(c4ccccc4)c4ccccc4)CC3)nccn2n1 |
| InChI | InChI=1S/C24H25N5/c1-19-18-22-24(25-12-13-29(22)26-19)28-16-14-27(15-17-28)23(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-13,18,23H,14-17H2,1H3 |
| InChIKey | LITAJXPXRNIHKK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 36.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(4-benzhydrylpiperazin-1-yl)-2-methylpyrazolo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-benzhydrylpiperazin-1-yl)-2-methylpyrazolo[1,5-a]pyrazine?
The IUPAC name of 4-(4-benzhydrylpiperazin-1-yl)-2-methylpyrazolo[1,5-a]pyrazine (CID 133487929) is 4-(4-benzhydrylpiperazin-1-yl)-2-methylpyrazolo[1,5-a]pyrazine.
What is the SMILES notation for 4-(4-benzhydrylpiperazin-1-yl)-2-methylpyrazolo[1,5-a]pyrazine?
The canonical SMILES for 4-(4-benzhydrylpiperazin-1-yl)-2-methylpyrazolo[1,5-a]pyrazine is Cc1cc2c(N3CCN(C(c4ccccc4)c4ccccc4)CC3)nccn2n1.
What is the InChIKey of 4-(4-benzhydrylpiperazin-1-yl)-2-methylpyrazolo[1,5-a]pyrazine?
The InChIKey is LITAJXPXRNIHKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25N5/c1-19-18-22-24(25-12-13-29(22)26-19)28-16-14-27(15-17-28)23(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-13,18,23H,14-17H2,1H3.
What are the key properties of 4-(4-benzhydrylpiperazin-1-yl)-2-methylpyrazolo[1,5-a]pyrazine?
4-(4-benzhydrylpiperazin-1-yl)-2-methylpyrazolo[1,5-a]pyrazine has a molecular weight of 383.50 g/mol, XLogP of 3.95, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-benzhydrylpiperazin-1-yl)-2-methylpyrazolo[1,5-a]pyrazine is sourced from PubChem (CID 133487929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).