C21H22N6O2 — CID 163357288
1-[1-(2-methylpyrazolo[1,5-a]pyrazin-4-yl)piperidin-4-yl]-3-phenylimidazolidine-2,4-dione (PubChem CID 163357288) has the molecular formula C21H22N6O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 1-[1-(2-methylpyrazolo[1,5-a]pyrazin-4-yl)piperidin-4-yl]-3-phenylimidazolidine-2,4-dione.
| Compound Name | 1-[1-(2-methylpyrazolo[1,5-a]pyrazin-4-yl)piperidin-4-yl]-3-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 163357288 |
| Molecular Formula | C21H22N6O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 1-[1-(2-methylpyrazolo[1,5-a]pyrazin-4-yl)piperidin-4-yl]-3-phenylimidazolidine-2,4-dione |
| SMILES | Cc1cc2c(N3CCC(N4CC(=O)N(c5ccccc5)C4=O)CC3)nccn2n1 |
| InChI | InChI=1S/C21H22N6O2/c1-15-13-18-20(22-9-12-26(18)23-15)24-10-7-16(8-11-24)25-14-19(28)27(21(25)29)17-5-3-2-4-6-17/h2-6,9,12-13,16H,7-8,10-11,14H2,1H3 |
| InChIKey | MSLWTBORWCCZIW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 74.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|