C18H17F3N4O — CID 133488992
2-[1-[5-(trifluoromethoxy)-2-pyridinyl]piperidin-4-yl]-1H-benzimidazole (PubChem CID 133488992) has the molecular formula C18H17F3N4O and a molecular weight of 362.36 g/mol. Its IUPAC name is 2-[1-[5-(trifluoromethoxy)-2-pyridinyl]piperidin-4-yl]-1H-benzimidazole.
| Compound Name | 2-[1-[5-(trifluoromethoxy)-2-pyridinyl]piperidin-4-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 133488992 |
| Molecular Formula | C18H17F3N4O |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2-[1-[5-(trifluoromethoxy)-2-pyridinyl]piperidin-4-yl]-1H-benzimidazole |
| SMILES | FC(F)(F)Oc1ccc(N2CCC(c3nc4ccccc4[nH]3)CC2)nc1 |
| InChI | InChI=1S/C18H17F3N4O/c19-18(20,21)26-13-5-6-16(22-11-13)25-9-7-12(8-10-25)17-23-14-3-1-2-4-15(14)24-17/h1-6,11-12H,7-10H2,(H,23,24) |
| InChIKey | AVJLFVPPXLTYDF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |