C14H18F3N3O2 — CID 133492261
1-tert-butyl-4-[[5-(trifluoromethoxy)-2-pyridinyl]amino]pyrrolidin-2-one (PubChem CID 133492261) has the molecular formula C14H18F3N3O2 and a molecular weight of 317.31 g/mol. Its IUPAC name is 1-tert-butyl-4-[[5-(trifluoromethoxy)-2-pyridinyl]amino]pyrrolidin-2-one.
| Compound Name | 1-tert-butyl-4-[[5-(trifluoromethoxy)-2-pyridinyl]amino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 133492261 |
| Molecular Formula | C14H18F3N3O2 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 1-tert-butyl-4-[[5-(trifluoromethoxy)-2-pyridinyl]amino]pyrrolidin-2-one |
| SMILES | CC(C)(C)N1CC(Nc2ccc(OC(F)(F)F)cn2)CC1=O |
| InChI | InChI=1S/C14H18F3N3O2/c1-13(2,3)20-8-9(6-12(20)21)19-11-5-4-10(7-18-11)22-14(15,16)17/h4-5,7,9H,6,8H2,1-3H3,(H,18,19) |
| InChIKey | ULLRLKVIHWACOQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |