C18H16N4O — CID 133498279
2-[4-(4-hydroxyphenyl)piperazin-1-yl]benzene-1,3-dicarbonitrile (PubChem CID 133498279) has the molecular formula C18H16N4O and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-[4-(4-hydroxyphenyl)piperazin-1-yl]benzene-1,3-dicarbonitrile.
| Compound Name | 2-[4-(4-hydroxyphenyl)piperazin-1-yl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 133498279 |
| Molecular Formula | C18H16N4O |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 2-[4-(4-hydroxyphenyl)piperazin-1-yl]benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cccc(C#N)c1N1CCN(c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C18H16N4O/c19-12-14-2-1-3-15(13-20)18(14)22-10-8-21(9-11-22)16-4-6-17(23)7-5-16/h1-7,23H,8-11H2 |
| InChIKey | HADJELSWJVGFGI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 74.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |