C15H15N3O — CID 154800229
2-(2-cyclopropylmorpholin-4-yl)benzene-1,3-dicarbonitrile (PubChem CID 154800229) has the molecular formula C15H15N3O and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-(2-cyclopropylmorpholin-4-yl)benzene-1,3-dicarbonitrile.
| Compound Name | 2-(2-cyclopropylmorpholin-4-yl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 154800229 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2-(2-cyclopropylmorpholin-4-yl)benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cccc(C#N)c1N1CCOC(C2CC2)C1 |
| InChI | InChI=1S/C15H15N3O/c16-8-12-2-1-3-13(9-17)15(12)18-6-7-19-14(10-18)11-4-5-11/h1-3,11,14H,4-7,10H2 |
| InChIKey | BSJJCIOFPHFSLC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 60.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |