C15H13BrN2O6 — CID 1335433
2-[4-bromo-2-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetic acid (PubChem CID 1335433) has the molecular formula C15H13BrN2O6 and a molecular weight of 397.18 g/mol. Its IUPAC name is 2-[4-bromo-2-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-bromo-2-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 1335433 |
| Molecular Formula | C15H13BrN2O6 |
| Molecular Weight | 397.18 g/mol |
| Exact Mass | 396.00 |
| IUPAC Name | 2-[4-bromo-2-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetic acid |
| SMILES | CN1C(=O)C(=Cc2cc(Br)ccc2OCC(=O)O)C(=O)N(C)C1=O |
| InChI | InChI=1S/C15H13BrN2O6/c1-17-13(21)10(14(22)18(2)15(17)23)6-8-5-9(16)3-4-11(8)24-7-12(19)20/h3-6H,7H2,1-2H3,(H,19,20) |
| InChIKey | CDNDEHDTGHEXPP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.18 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|