C6H7N3O — CID 13359978
1-(3-methyl-1,2,4-triazin-5-yl)ethanone (PubChem CID 13359978) has the molecular formula C6H7N3O and a molecular weight of 137.14 g/mol. Its IUPAC name is 1-(3-methyl-1,2,4-triazin-5-yl)ethanone.
| Compound Name | 1-(3-methyl-1,2,4-triazin-5-yl)ethanone |
|---|---|
| PubChem CID | 13359978 |
| Molecular Formula | C6H7N3O |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | 1-(3-methyl-1,2,4-triazin-5-yl)ethanone |
| SMILES | CC(=O)c1cnnc(C)n1 |
| InChI | InChI=1S/C6H7N3O/c1-4(10)6-3-7-9-5(2)8-6/h3H,1-2H3 |
| InChIKey | UJPXJGIEIYRBJC-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |