C22H26N2O4 — CID 13362420
methyl 1,1'-dimethyl-2'-oxospiro[1,4a,5,5a,7,8,10,10a-octahydropyrano[3,4-f]indolizine-6,3'-indole]-4-carboxylate (PubChem CID 13362420) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is methyl 1,1'-dimethyl-2'-oxospiro[1,4a,5,5a,7,8,10,10a-octahydropyrano[3,4-f]indolizine-6,3'-indole]-4-carboxylate.
| Compound Name | methyl 1,1'-dimethyl-2'-oxospiro[1,4a,5,5a,7,8,10,10a-octahydropyrano[3,4-f]indolizine-6,3'-indole]-4-carboxylate |
|---|---|
| PubChem CID | 13362420 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | methyl 1,1'-dimethyl-2'-oxospiro[1,4a,5,5a,7,8,10,10a-octahydropyrano[3,4-f]indolizine-6,3'-indole]-4-carboxylate |
| SMILES | COC(=O)C1=COC(C)C2CN3CCC4(C(=O)N(C)c5ccccc54)C3CC12 |
| InChI | InChI=1S/C22H26N2O4/c1-13-15-11-24-9-8-22(17-6-4-5-7-18(17)23(2)21(22)26)19(24)10-14(15)16(12-28-13)20(25)27-3/h4-7,12-15,19H,8-11H2,1-3H3 |
| InChIKey | UTVSHFGLVLURNU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |