C29H31NO6 — CID 13364581
(4-nitrophenyl) 2,2-dimethyl-7-(2-methylpropyl)-5-phenylmethoxy-3,4-dihydrochromene-4-carboxylate (PubChem CID 13364581) has the molecular formula C29H31NO6 and a molecular weight of 489.57 g/mol. Its IUPAC name is (4-nitrophenyl) 2,2-dimethyl-7-(2-methylpropyl)-5-phenylmethoxy-3,4-dihydrochromene-4-carboxylate.
| Compound Name | (4-nitrophenyl) 2,2-dimethyl-7-(2-methylpropyl)-5-phenylmethoxy-3,4-dihydrochromene-4-carboxylate |
|---|---|
| PubChem CID | 13364581 |
| Molecular Formula | C29H31NO6 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | (4-nitrophenyl) 2,2-dimethyl-7-(2-methylpropyl)-5-phenylmethoxy-3,4-dihydrochromene-4-carboxylate |
| SMILES | CC(C)Cc1cc(OCc2ccccc2)c2c(c1)OC(C)(C)CC2C(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H31NO6/c1-19(2)14-21-15-25(34-18-20-8-6-5-7-9-20)27-24(17-29(3,4)36-26(27)16-21)28(31)35-23-12-10-22(11-13-23)30(32)33/h5-13,15-16,19,24H,14,17-18H2,1-4H3 |
| InChIKey | ONHQVVSKBHKJSJ-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|