C30H33NO6 — CID 19848808
(4-nitrophenyl) 8-hydroxy-3,3-dimethyl-6-(5-phenylpentoxy)-2,4-dihydro-1H-naphthalene-1-carboxylate (PubChem CID 19848808) has the molecular formula C30H33NO6 and a molecular weight of 503.60 g/mol. Its IUPAC name is (4-nitrophenyl) 8-hydroxy-3,3-dimethyl-6-(5-phenylpentoxy)-2,4-dihydro-1H-naphthalene-1-carboxylate.
| Compound Name | (4-nitrophenyl) 8-hydroxy-3,3-dimethyl-6-(5-phenylpentoxy)-2,4-dihydro-1H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 19848808 |
| Molecular Formula | C30H33NO6 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | (4-nitrophenyl) 8-hydroxy-3,3-dimethyl-6-(5-phenylpentoxy)-2,4-dihydro-1H-naphthalene-1-carboxylate |
| SMILES | CC1(C)Cc2cc(OCCCCCc3ccccc3)cc(O)c2C(C(=O)Oc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C30H33NO6/c1-30(2)19-22-17-25(36-16-8-4-7-11-21-9-5-3-6-10-21)18-27(32)28(22)26(20-30)29(33)37-24-14-12-23(13-15-24)31(34)35/h3,5-6,9-10,12-15,17-18,26,32H,4,7-8,11,16,19-20H2,1-2H3 |
| InChIKey | IRFIIOGHTSFAEV-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|