C8H12N2O2 — CID 13366347
4-butyl-1H-pyrazine-2,3-dione (PubChem CID 13366347) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 4-butyl-1H-pyrazine-2,3-dione.
| Compound Name | 4-butyl-1H-pyrazine-2,3-dione |
|---|---|
| PubChem CID | 13366347 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 4-butyl-1H-pyrazine-2,3-dione |
| SMILES | CCCCn1cc[nH]c(=O)c1=O |
| InChI | InChI=1S/C8H12N2O2/c1-2-3-5-10-6-4-9-7(11)8(10)12/h4,6H,2-3,5H2,1H3,(H,9,11) |
| InChIKey | ZAOZYIYKOAKHEN-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|