C6H10N2O2 — CID 66844377
1,4-dihydropyrazine-2,3-dione;ethane (PubChem CID 66844377) has the molecular formula C6H10N2O2 and a molecular weight of 142.16 g/mol. Its IUPAC name is 1,4-dihydropyrazine-2,3-dione;ethane.
| Compound Name | 1,4-dihydropyrazine-2,3-dione;ethane |
|---|---|
| PubChem CID | 66844377 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | 1,4-dihydropyrazine-2,3-dione;ethane |
| SMILES | CC.O=c1[nH]cc[nH]c1=O |
| InChI | InChI=1S/C4H4N2O2.C2H6/c7-3-4(8)6-2-1-5-3;1-2/h1-2H,(H,5,7)(H,6,8);1-2H3 |
| InChIKey | OOXJXEDDFBQZBT-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|