C16H12ClN3O3S2 — CID 1336667
4-[(4-chlorophenyl)sulfonylamino]-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 1336667) has the molecular formula C16H12ClN3O3S2 and a molecular weight of 393.88 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)sulfonylamino]-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-[(4-chlorophenyl)sulfonylamino]-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 1336667 |
| Molecular Formula | C16H12ClN3O3S2 |
| Molecular Weight | 393.88 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | 4-[(4-chlorophenyl)sulfonylamino]-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nccs1)c1ccc(NS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H12ClN3O3S2/c17-12-3-7-14(8-4-12)25(22,23)20-13-5-1-11(2-6-13)15(21)19-16-18-9-10-24-16/h1-10,20H,(H,18,19,21) |
| InChIKey | SFYMNLHZBPJJCB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.88 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |