C20H13F8NO — CID 13371350
2-[4,5-bis(4-fluorophenyl)-1-methylpyrrol-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 13371350) has the molecular formula C20H13F8NO and a molecular weight of 435.31 g/mol. Its IUPAC name is 2-[4,5-bis(4-fluorophenyl)-1-methylpyrrol-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4,5-bis(4-fluorophenyl)-1-methylpyrrol-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 13371350 |
| Molecular Formula | C20H13F8NO |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 2-[4,5-bis(4-fluorophenyl)-1-methylpyrrol-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Cn1c(C(O)(C(F)(F)F)C(F)(F)F)cc(-c2ccc(F)cc2)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H13F8NO/c1-29-16(18(30,19(23,24)25)20(26,27)28)10-15(11-2-6-13(21)7-3-11)17(29)12-4-8-14(22)9-5-12/h2-10,30H,1H3 |
| InChIKey | NFBZRZPXECOWED-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |