C13H19N3O2S — CID 13373549
(NE)-N-(1-propylpiperidin-2-ylidene)pyridine-3-sulfonamide (PubChem CID 13373549) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is (NE)-N-(1-propylpiperidin-2-ylidene)pyridine-3-sulfonamide.
| Compound Name | (NE)-N-(1-propylpiperidin-2-ylidene)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 13373549 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | (NE)-N-(1-propylpiperidin-2-ylidene)pyridine-3-sulfonamide |
| SMILES | CCCN1CCCC/C1=N\S(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C13H19N3O2S/c1-2-9-16-10-4-3-7-13(16)15-19(17,18)12-6-5-8-14-11-12/h5-6,8,11H,2-4,7,9-10H2,1H3/b15-13+ |
| InChIKey | NABLNNUSRGYDKL-FYWRMAATSA-N |
| XLogP | 2.06 |
| TPSA | 62.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|