About 3-pyridin-3-yl-6,7-dihydro-5H-pyrrolizine-1-carbonitrile
3-pyridin-3-yl-6,7-dihydro-5H-pyrrolizine-1-carbonitrile (PubChem CID 13375485) has the molecular formula C13H11N3
and a molecular weight of 209.25 g/mol. Its IUPAC name is 3-pyridin-3-yl-6,7-dihydro-5H-pyrrolizine-1-carbonitrile.
Molecular Properties
| Compound Name | 3-pyridin-3-yl-6,7-dihydro-5H-pyrrolizine-1-carbonitrile |
| PubChem CID | 13375485 |
| Molecular Formula | C13H11N3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 3-pyridin-3-yl-6,7-dihydro-5H-pyrrolizine-1-carbonitrile |
| SMILES | N#Cc1cc(-c2cccnc2)n2c1CCC2 |
| InChI | InChI=1S/C13H11N3/c14-8-11-7-13(10-3-1-5-15-9-10)16-6-2-4-12(11)16/h1,3,5,7,9H,2,4,6H2 |
| InChIKey | YKXYNFLMXZEZSN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-pyridin-3-yl-6,7-dihydro-5H-pyrrolizine-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-3-yl-6,7-dihydro-5H-pyrrolizine-1-carbonitrile?
The IUPAC name of 3-pyridin-3-yl-6,7-dihydro-5H-pyrrolizine-1-carbonitrile (CID 13375485) is 3-pyridin-3-yl-6,7-dihydro-5H-pyrrolizine-1-carbonitrile.
What is the SMILES notation for 3-pyridin-3-yl-6,7-dihydro-5H-pyrrolizine-1-carbonitrile?
The canonical SMILES for 3-pyridin-3-yl-6,7-dihydro-5H-pyrrolizine-1-carbonitrile is N#Cc1cc(-c2cccnc2)n2c1CCC2.
What is the InChIKey of 3-pyridin-3-yl-6,7-dihydro-5H-pyrrolizine-1-carbonitrile?
The InChIKey is YKXYNFLMXZEZSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3/c14-8-11-7-13(10-3-1-5-15-9-10)16-6-2-4-12(11)16/h1,3,5,7,9H,2,4,6H2.
What are the key properties of 3-pyridin-3-yl-6,7-dihydro-5H-pyrrolizine-1-carbonitrile?
3-pyridin-3-yl-6,7-dihydro-5H-pyrrolizine-1-carbonitrile has a molecular weight of 209.25 g/mol, XLogP of 2.37, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-3-yl-6,7-dihydro-5H-pyrrolizine-1-carbonitrile is sourced from PubChem (CID 13375485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).