C15H15FN2O — CID 57197679
2-(2-fluoro-3-pyridin-3-yl-5,6,7,8-tetrahydroindolizin-1-yl)acetaldehyde (PubChem CID 57197679) has the molecular formula C15H15FN2O and a molecular weight of 258.30 g/mol. Its IUPAC name is 2-(2-fluoro-3-pyridin-3-yl-5,6,7,8-tetrahydroindolizin-1-yl)acetaldehyde.
| Compound Name | 2-(2-fluoro-3-pyridin-3-yl-5,6,7,8-tetrahydroindolizin-1-yl)acetaldehyde |
|---|---|
| PubChem CID | 57197679 |
| Molecular Formula | C15H15FN2O |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 2-(2-fluoro-3-pyridin-3-yl-5,6,7,8-tetrahydroindolizin-1-yl)acetaldehyde |
| SMILES | O=CCc1c(F)c(-c2cccnc2)n2c1CCCC2 |
| InChI | InChI=1S/C15H15FN2O/c16-14-12(6-9-19)13-5-1-2-8-18(13)15(14)11-4-3-7-17-10-11/h3-4,7,9-10H,1-2,5-6,8H2 |
| InChIKey | BHMZXYBBEGSLNC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|